C6H9N3O2 — CID 57357509
5-amino-3,6-dimethyl-1H-pyrimidine-2,4-dione (PubChem CID 57357509) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 5-amino-3,6-dimethyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-amino-3,6-dimethyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57357509 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 5-amino-3,6-dimethyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH]c(=O)n(C)c(=O)c1N |
| InChI | InChI=1S/C6H9N3O2/c1-3-4(7)5(10)9(2)6(11)8-3/h7H2,1-2H3,(H,8,11) |
| InChIKey | DMYXWQPNMMVHBF-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |