C7H10IN3O2 — CID 155513597
6-[(dimethylamino)methyl]-5-iodo-1H-pyrimidine-2,4-dione (PubChem CID 155513597) has the molecular formula C7H10IN3O2 and a molecular weight of 295.08 g/mol. Its IUPAC name is 6-[(dimethylamino)methyl]-5-iodo-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(dimethylamino)methyl]-5-iodo-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155513597 |
| Molecular Formula | C7H10IN3O2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 6-[(dimethylamino)methyl]-5-iodo-1H-pyrimidine-2,4-dione |
| SMILES | CN(C)Cc1[nH]c(=O)[nH]c(=O)c1I |
| InChI | InChI=1S/C7H10IN3O2/c1-11(2)3-4-5(8)6(12)10-7(13)9-4/h3H2,1-2H3,(H2,9,10,12,13) |
| InChIKey | DMZAJIRJHCRTQY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|