C28H35F3N4O9 — CID 57357684
bis(but-2-enedioic acid);7-[2-(1H-imidazol-5-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]octanamide (PubChem CID 57357684) has the molecular formula C28H35F3N4O9 and a molecular weight of 628.60 g/mol. Its IUPAC name is bis(but-2-enedioic acid);7-[2-(1H-imidazol-5-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]octanamide.
| Compound Name | bis(but-2-enedioic acid);7-[2-(1H-imidazol-5-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 57357684 |
| Molecular Formula | C28H35F3N4O9 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | bis(but-2-enedioic acid);7-[2-(1H-imidazol-5-yl)ethylamino]-N-[4-(trifluoromethyl)phenyl]octanamide |
| SMILES | CC(CCCCCC(=O)Nc1ccc(C(F)(F)F)cc1)NCCc1cnc[nH]1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H27F3N4O.2C4H4O4/c1-15(25-12-11-18-13-24-14-26-18)5-3-2-4-6-19(28)27-17-9-7-16(8-10-17)20(21,22)23;2*5-3(6)1-2-4(7)8/h7-10,13-15,25H,2-6,11-12H2,1H3,(H,24,26)(H,27,28);2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | DXOVFWVKXMKZCN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 219.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|