C21H22N6O2 — CID 57359423
2-[5-[(3-propylquinoxalin-2-yl)amino]benzotriazol-1-yl]butanoic acid (PubChem CID 57359423) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-[5-[(3-propylquinoxalin-2-yl)amino]benzotriazol-1-yl]butanoic acid.
| Compound Name | 2-[5-[(3-propylquinoxalin-2-yl)amino]benzotriazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 57359423 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[5-[(3-propylquinoxalin-2-yl)amino]benzotriazol-1-yl]butanoic acid |
| SMILES | CCCc1nc2ccccc2nc1Nc1ccc2c(c1)nnn2C(CC)C(=O)O |
| InChI | InChI=1S/C21H22N6O2/c1-3-7-16-20(24-15-9-6-5-8-14(15)23-16)22-13-10-11-19-17(12-13)25-26-27(19)18(4-2)21(28)29/h5-6,8-12,18H,3-4,7H2,1-2H3,(H,22,24)(H,28,29) |
| InChIKey | OZTOENNFAMWXBM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |