C19H33ClN2O2S — CID 57359714
3-(3-amino-4-chlorododecyl)-2-methylbenzenesulfonamide (PubChem CID 57359714) has the molecular formula C19H33ClN2O2S and a molecular weight of 389.01 g/mol. Its IUPAC name is 3-(3-amino-4-chlorododecyl)-2-methylbenzenesulfonamide.
| Compound Name | 3-(3-amino-4-chlorododecyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57359714 |
| Molecular Formula | C19H33ClN2O2S |
| Molecular Weight | 389.01 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-(3-amino-4-chlorododecyl)-2-methylbenzenesulfonamide |
| SMILES | CCCCCCCCC(Cl)C(N)CCc1cccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C19H33ClN2O2S/c1-3-4-5-6-7-8-11-17(20)18(21)14-13-16-10-9-12-19(15(16)2)25(22,23)24/h9-10,12,17-18H,3-8,11,13-14,21H2,1-2H3,(H2,22,23,24) |
| InChIKey | RDTJMRCIUVNUEM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.01 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|