C16H16F6N3O2- — CID 57360456
N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamate (PubChem CID 57360456) has the molecular formula C16H16F6N3O2- and a molecular weight of 396.31 g/mol. Its IUPAC name is N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamate.
| Compound Name | N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 57360456 |
| Molecular Formula | C16H16F6N3O2- |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-ethyl-N-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamate |
| SMILES | CCN(C(=O)[O-])C(NCCC1C=Nc2ccccc21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17F6N3O2/c1-2-25(13(26)27)14(15(17,18)19,16(20,21)22)24-8-7-10-9-23-12-6-4-3-5-11(10)12/h3-6,9-10,24H,2,7-8H2,1H3,(H,26,27)/p-1 |
| InChIKey | NMNSVZFBYOHGTL-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|