C16H17F6N3O2 — CID 57360457
ethyl-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamic acid (PubChem CID 57360457) has the molecular formula C16H17F6N3O2 and a molecular weight of 397.32 g/mol. Its IUPAC name is ethyl-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamic acid.
| Compound Name | ethyl-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 57360457 |
| Molecular Formula | C16H17F6N3O2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | ethyl-[1,1,1,3,3,3-hexafluoro-2-[2-(3H-indol-3-yl)ethylamino]propan-2-yl]carbamic acid |
| SMILES | CCN(C(=O)O)C(NCCC1C=Nc2ccccc21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17F6N3O2/c1-2-25(13(26)27)14(15(17,18)19,16(20,21)22)24-8-7-10-9-23-12-6-4-3-5-11(10)12/h3-6,9-10,24H,2,7-8H2,1H3,(H,26,27) |
| InChIKey | NMNSVZFBYOHGTL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|