C16H18F6N3O2+ — CID 7236121
[2-(ethoxycarbonylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-[2-[(3S)-3H-indol-3-yl]ethyl]azanium (PubChem CID 7236121) has the molecular formula C16H18F6N3O2+ and a molecular weight of 398.33 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-[2-[(3S)-3H-indol-3-yl]ethyl]azanium.
| Compound Name | [2-(ethoxycarbonylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-[2-[(3S)-3H-indol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7236121 |
| Molecular Formula | C16H18F6N3O2+ |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-(ethoxycarbonylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-[2-[(3S)-3H-indol-3-yl]ethyl]azanium |
| SMILES | CCOC(=O)NC([NH2+]CC[C@@H]1C=Nc2ccccc21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H17F6N3O2/c1-2-27-13(26)25-14(15(17,18)19,16(20,21)22)24-8-7-10-9-23-12-6-4-3-5-11(10)12/h3-6,9-10,24H,2,7-8H2,1H3,(H,25,26)/p+1/t10-/m1/s1 |
| InChIKey | ZETZIXQVQJONKM-SNVBAGLBSA-O |
| XLogP | 3.01 |
| TPSA | 67.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|