C12H17NO2 — CID 57360583
(N,2-diethylanilino) acetate (PubChem CID 57360583) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (N,2-diethylanilino) acetate.
| Compound Name | (N,2-diethylanilino) acetate |
|---|---|
| PubChem CID | 57360583 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (N,2-diethylanilino) acetate |
| SMILES | CCc1ccccc1N(CC)OC(C)=O |
| InChI | InChI=1S/C12H17NO2/c1-4-11-8-6-7-9-12(11)13(5-2)15-10(3)14/h6-9H,4-5H2,1-3H3 |
| InChIKey | IADREIFNVYDKGE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|