C22H36O2S — CID 57369046
3-[(8R,9S,10R,13S,14S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanethial (PubChem CID 57369046) has the molecular formula C22H36O2S and a molecular weight of 364.60 g/mol. Its IUPAC name is 3-[(8R,9S,10R,13S,14S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanethial.
| Compound Name | 3-[(8R,9S,10R,13S,14S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanethial |
|---|---|
| PubChem CID | 57369046 |
| Molecular Formula | C22H36O2S |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 3-[(8R,9S,10R,13S,14S)-3,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl]propanethial |
| SMILES | C[C@]12CCC(O)C(CCC=S)C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C22H36O2S/c1-21-12-10-19(23)15(4-3-13-25)17(21)6-5-14-16-7-8-20(24)22(16,2)11-9-18(14)21/h13-20,23-24H,3-12H2,1-2H3/t14-,15?,16-,17?,18-,19?,20?,21-,22-/m0/s1 |
| InChIKey | MHNTVBPEBXWYQS-XIVCYIIXSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|