C9H12N5O5- — CID 57371879
N-[2-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)amino]-2-oxoethyl]-N-ethylcarbamate (PubChem CID 57371879) has the molecular formula C9H12N5O5- and a molecular weight of 270.22 g/mol. Its IUPAC name is N-[2-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)amino]-2-oxoethyl]-N-ethylcarbamate.
| Compound Name | N-[2-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)amino]-2-oxoethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 57371879 |
| Molecular Formula | C9H12N5O5- |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[2-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)amino]-2-oxoethyl]-N-ethylcarbamate |
| SMILES | CCN(CC(=O)Nc1c(O)nc(N)[nH]c1=O)C(=O)[O-] |
| InChI | InChI=1S/C9H13N5O5/c1-2-14(9(18)19)3-4(15)11-5-6(16)12-8(10)13-7(5)17/h2-3H2,1H3,(H,11,15)(H,18,19)(H4,10,12,13,16,17)/p-1 |
| InChIKey | CUKWVGFGIYCDRE-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |