C14H20N4O4Y-2 — CID 58819988
1,3-dibutyl-7,8-dihydropurin-8-ide-2,6-dione;hydroxymethanone;yttrium (PubChem CID 58819988) has the molecular formula C14H20N4O4Y-2 and a molecular weight of 397.24 g/mol. Its IUPAC name is 1,3-dibutyl-7,8-dihydropurin-8-ide-2,6-dione;hydroxymethanone;yttrium.
| Compound Name | 1,3-dibutyl-7,8-dihydropurin-8-ide-2,6-dione;hydroxymethanone;yttrium |
|---|---|
| PubChem CID | 58819988 |
| Molecular Formula | C14H20N4O4Y-2 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1,3-dibutyl-7,8-dihydropurin-8-ide-2,6-dione;hydroxymethanone;yttrium |
| SMILES | CCCCn1c(=O)c2[nH][c-]nc2n(CCCC)c1=O.O=[C-]O.[Y] |
| InChI | InChI=1S/C13H19N4O2.CHO2.Y/c1-3-5-7-16-11-10(14-9-15-11)12(18)17(13(16)19)8-6-4-2;2-1-3;/h3-8H2,1-2H3,(H,14,15);(H,2,3);/q2*-1; |
| InChIKey | RPDGXQHSNGPVRA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|