C11H15N5O3 — CID 153282951
N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide (PubChem CID 153282951) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide.
| Compound Name | N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide |
|---|---|
| PubChem CID | 153282951 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide |
| SMILES | CCCCn1c(=O)[nH]c2nc(NC(C)=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C11H15N5O3/c1-3-4-5-16-7-8(14-11(16)19)13-10(12-6(2)17)15-9(7)18/h3-5H2,1-2H3,(H3,12,13,14,15,17,18,19) |
| InChIKey | ZEZCPLYSEDUKQI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |