C8H11BrN4O2 — CID 21966
1,3,7-trimethyl-7H-purin-7-ium-2,6-dione bromide (PubChem CID 21966) has the molecular formula C8H11BrN4O2 and a molecular weight of 275.11 g/mol. Its IUPAC name is 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione bromide.
| Compound Name | 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione bromide |
|---|---|
| PubChem CID | 21966 |
| Molecular Formula | C8H11BrN4O2 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1,3,7-trimethyl-7H-purin-7-ium-2,6-dione bromide |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[NH+](C)C=N2.[Br-] |
| InChI | InChI=1S/C8H10N4O2.BrH/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3;1H |
| InChIKey | XXSSHQCOBPQFOL-UHFFFAOYSA-N |
| XLogP | -5.09 |
| TPSA | 60.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |