C12H17N5O2 — CID 135503541
2-amino-9-butyl-7-prop-2-enyl-1H-purine-6,8-dione (PubChem CID 135503541) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-amino-9-butyl-7-prop-2-enyl-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-butyl-7-prop-2-enyl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 135503541 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-amino-9-butyl-7-prop-2-enyl-1H-purine-6,8-dione |
| SMILES | C=CCn1c(=O)n(CCCC)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C12H17N5O2/c1-3-5-7-17-9-8(10(18)15-11(13)14-9)16(6-4-2)12(17)19/h4H,2-3,5-7H2,1H3,(H3,13,14,15,18) |
| InChIKey | NNNPBPBLPBYRBJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|