C14H21N4O2+ — CID 18961905
7-hept-6-enyl-3,7-dimethylpurin-7-ium-2,6-dione (PubChem CID 18961905) has the molecular formula C14H21N4O2+ and a molecular weight of 277.35 g/mol. Its IUPAC name is 7-hept-6-enyl-3,7-dimethylpurin-7-ium-2,6-dione.
| Compound Name | 7-hept-6-enyl-3,7-dimethylpurin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 18961905 |
| Molecular Formula | C14H21N4O2+ |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 7-hept-6-enyl-3,7-dimethylpurin-7-ium-2,6-dione |
| SMILES | C=CCCCCC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H20N4O2/c1-4-5-6-7-8-9-18(3)10-15-12-11(18)13(19)16-14(20)17(12)2/h4,10H,1,5-9H2,2-3H3/p+1 |
| InChIKey | KBQXHZOUIJFSIA-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|