C11H17N5O2 — CID 135415605
2-amino-9-hexyl-1,7-dihydropurine-6,8-dione (PubChem CID 135415605) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-amino-9-hexyl-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-hexyl-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 135415605 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-amino-9-hexyl-1,7-dihydropurine-6,8-dione |
| SMILES | CCCCCCn1c(=O)[nH]c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H17N5O2/c1-2-3-4-5-6-16-8-7(13-11(16)18)9(17)15-10(12)14-8/h2-6H2,1H3,(H,13,18)(H3,12,14,15,17) |
| InChIKey | XDJHEZVQEHEHBM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|