About 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one
2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one (PubChem CID 135415603) has the molecular formula C10H15N5OS
and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one |
| PubChem CID | 135415603 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one |
| SMILES | CCCCCn1c(=S)[nH]c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H15N5OS/c1-2-3-4-5-15-7-6(12-10(15)17)8(16)14-9(11)13-7/h2-5H2,1H3,(H,12,17)(H3,11,13,14,16) |
| InChIKey | RRXCTKPEXYODFF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The IUPAC name of 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one (CID 135415603) is 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one.
What is the SMILES notation for 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The canonical SMILES for 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one is CCCCCn1c(=S)[nH]c2c(=O)[nH]c(N)nc21.
What is the InChIKey of 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one?
The InChIKey is RRXCTKPEXYODFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5OS/c1-2-3-4-5-15-7-6(12-10(15)17)8(16)14-9(11)13-7/h2-5H2,1H3,(H,12,17)(H3,11,13,14,16).
What are the key properties of 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one?
2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one has a molecular weight of 253.33 g/mol, XLogP of 1.55, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one is sourced from PubChem (CID 135415603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).