C10H15N5OS — CID 135415603
2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one (PubChem CID 135415603) has the molecular formula C10H15N5OS and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135415603 |
| Molecular Formula | C10H15N5OS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-amino-9-pentyl-8-sulfanylidene-1,7-dihydropurin-6-one |
| SMILES | CCCCCn1c(=S)[nH]c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H15N5OS/c1-2-3-4-5-15-7-6(12-10(15)17)8(16)14-9(11)13-7/h2-5H2,1H3,(H,12,17)(H3,11,13,14,16) |
| InChIKey | RRXCTKPEXYODFF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|