C25H27N2O6- — CID 57374998
N-tert-butyl-N-[2-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]anilino]-2-oxoethyl]carbamate (PubChem CID 57374998) has the molecular formula C25H27N2O6- and a molecular weight of 451.50 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | N-tert-butyl-N-[2-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 57374998 |
| Molecular Formula | C25H27N2O6- |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-tert-butyl-N-[2-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]anilino]-2-oxoethyl]carbamate |
| SMILES | CCC(c1cccc(NC(=O)CN(C(=O)[O-])C(C)(C)C)c1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C25H28N2O6/c1-5-17(21-22(29)18-11-6-7-12-19(18)33-23(21)30)15-9-8-10-16(13-15)26-20(28)14-27(24(31)32)25(2,3)4/h6-13,17,29H,5,14H2,1-4H3,(H,26,28)(H,31,32)/p-1 |
| InChIKey | GNAABBJPKGSBMN-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|