C26H30N2O6 — CID 54690946
tert-butyl N-(2-aminopropanoyl)-N-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]phenyl]carbamate (PubChem CID 54690946) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is tert-butyl N-(2-aminopropanoyl)-N-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]phenyl]carbamate.
| Compound Name | tert-butyl N-(2-aminopropanoyl)-N-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]phenyl]carbamate |
|---|---|
| PubChem CID | 54690946 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | tert-butyl N-(2-aminopropanoyl)-N-[3-[1-(4-hydroxy-2-oxochromen-3-yl)propyl]phenyl]carbamate |
| SMILES | CCC(c1cccc(N(C(=O)OC(C)(C)C)C(=O)C(C)N)c1)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C26H30N2O6/c1-6-18(21-22(29)19-12-7-8-13-20(19)33-24(21)31)16-10-9-11-17(14-16)28(23(30)15(2)27)25(32)34-26(3,4)5/h7-15,18,29H,6,27H2,1-5H3 |
| InChIKey | RGFFSVWOGSTBCL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|