C17H20NO3- — CID 57375133
2-(8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butanoate (PubChem CID 57375133) has the molecular formula C17H20NO3- and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-(8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butanoate.
| Compound Name | 2-(8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butanoate |
|---|---|
| PubChem CID | 57375133 |
| Molecular Formula | C17H20NO3- |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(8-ethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)butanoate |
| SMILES | CCc1cccc2c3c([nH]c12)C(C(CC)C(=O)[O-])OCC3 |
| InChI | InChI=1S/C17H21NO3/c1-3-10-6-5-7-12-13-8-9-21-16(11(4-2)17(19)20)15(13)18-14(10)12/h5-7,11,16,18H,3-4,8-9H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | KAKHKKMQMAWIHH-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |