C29H32N6O — CID 57375837
N'-cyclopentyl-2-[5-[4-[(cyclopentylhydrazinylidene)methyl]phenyl]furan-2-yl]-3H-benzimidazole-5-carboximidamide (PubChem CID 57375837) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is N'-cyclopentyl-2-[5-[4-[(cyclopentylhydrazinylidene)methyl]phenyl]furan-2-yl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | N'-cyclopentyl-2-[5-[4-[(cyclopentylhydrazinylidene)methyl]phenyl]furan-2-yl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 57375837 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | N'-cyclopentyl-2-[5-[4-[(cyclopentylhydrazinylidene)methyl]phenyl]furan-2-yl]-3H-benzimidazole-5-carboximidamide |
| SMILES | N/C(=N\C1CCCC1)c1ccc2nc(-c3ccc(-c4ccc(C=NNC5CCCC5)cc4)o3)[nH]c2c1 |
| InChI | InChI=1S/C29H32N6O/c30-28(32-22-5-1-2-6-22)21-13-14-24-25(17-21)34-29(33-24)27-16-15-26(36-27)20-11-9-19(10-12-20)18-31-35-23-7-3-4-8-23/h9-18,22-23,35H,1-8H2,(H2,30,32)(H,33,34) |
| InChIKey | RTVMAJLEPAGGFM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|