About 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid
4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid (PubChem CID 4915243) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid |
| PubChem CID | 4915243 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid |
| SMILES | N/C(=N\C1CCCCC1)c1ccc2nc(-c3ccc(C(=O)O)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H22N4O2/c22-19(23-16-4-2-1-3-5-16)15-10-11-17-18(12-15)25-20(24-17)13-6-8-14(9-7-13)21(26)27/h6-12,16H,1-5H2,(H2,22,23)(H,24,25)(H,26,27) |
| InChIKey | XAVAUWOUKKDEPF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid?
The IUPAC name of 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid (CID 4915243) is 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid.
What is the SMILES notation for 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid?
The canonical SMILES for 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid is N/C(=N\C1CCCCC1)c1ccc2nc(-c3ccc(C(=O)O)cc3)[nH]c2c1.
What is the InChIKey of 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid?
The InChIKey is XAVAUWOUKKDEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O2/c22-19(23-16-4-2-1-3-5-16)15-10-11-17-18(12-15)25-20(24-17)13-6-8-14(9-7-13)21(26)27/h6-12,16H,1-5H2,(H2,22,23)(H,24,25)(H,26,27).
What are the key properties of 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid?
4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid has a molecular weight of 362.43 g/mol, XLogP of 3.97, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(N'-cyclohexylcarbamimidoyl)-1H-benzimidazol-2-yl]benzoic acid is sourced from PubChem (CID 4915243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).