C10H9ClN4 — CID 57379922
4-[2-(2-chlorophenyl)aziridin-1-yl]-1,2,4-triazole (PubChem CID 57379922) has the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)aziridin-1-yl]-1,2,4-triazole.
| Compound Name | 4-[2-(2-chlorophenyl)aziridin-1-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 57379922 |
| Molecular Formula | C10H9ClN4 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-[2-(2-chlorophenyl)aziridin-1-yl]-1,2,4-triazole |
| SMILES | Clc1ccccc1C1CN1n1cnnc1 |
| InChI | InChI=1S/C10H9ClN4/c11-9-4-2-1-3-8(9)10-5-15(10)14-6-12-13-7-14/h1-4,6-7,10H,5H2 |
| InChIKey | WCDDWEZIOZRCES-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 33.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|