C17H16Cl2N2O2 — CID 101045957
N-[(2S,6S)-2,6-bis(2-chlorophenyl)-1-hydroxypiperidin-4-ylidene]hydroxylamine (PubChem CID 101045957) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is N-[(2S,6S)-2,6-bis(2-chlorophenyl)-1-hydroxypiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[(2S,6S)-2,6-bis(2-chlorophenyl)-1-hydroxypiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 101045957 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[(2S,6S)-2,6-bis(2-chlorophenyl)-1-hydroxypiperidin-4-ylidene]hydroxylamine |
| SMILES | ON=C1C[C@@H](c2ccccc2Cl)N(O)[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-14-7-3-1-5-12(14)16-9-11(20-22)10-17(21(16)23)13-6-2-4-8-15(13)19/h1-8,16-17,22-23H,9-10H2/t16-,17-/m0/s1 |
| InChIKey | CFKLEUPUWZKGFV-IRXDYDNUSA-N |
| XLogP | 5.09 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|