About S-naphthalen-1-yl (E)-5-methylhex-3-enethioate
S-naphthalen-1-yl (E)-5-methylhex-3-enethioate (PubChem CID 57382111) has the molecular formula C17H18OS
and a molecular weight of 270.40 g/mol. Its IUPAC name is S-naphthalen-1-yl (E)-5-methylhex-3-enethioate.
Molecular Properties
| Compound Name | S-naphthalen-1-yl (E)-5-methylhex-3-enethioate |
| PubChem CID | 57382111 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | S-naphthalen-1-yl (E)-5-methylhex-3-enethioate |
| SMILES | CC(C)/C=C/CC(=O)Sc1cccc2ccccc12 |
| InChI | InChI=1S/C17H18OS/c1-13(2)7-5-12-17(18)19-16-11-6-9-14-8-3-4-10-15(14)16/h3-11,13H,12H2,1-2H3/b7-5+ |
| InChIKey | KGYOUZDXYTXHNW-FNORWQNLSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-naphthalen-1-yl (E)-5-methylhex-3-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-naphthalen-1-yl (E)-5-methylhex-3-enethioate?
The IUPAC name of S-naphthalen-1-yl (E)-5-methylhex-3-enethioate (CID 57382111) is S-naphthalen-1-yl (E)-5-methylhex-3-enethioate.
What is the SMILES notation for S-naphthalen-1-yl (E)-5-methylhex-3-enethioate?
The canonical SMILES for S-naphthalen-1-yl (E)-5-methylhex-3-enethioate is CC(C)/C=C/CC(=O)Sc1cccc2ccccc12.
What is the InChIKey of S-naphthalen-1-yl (E)-5-methylhex-3-enethioate?
The InChIKey is KGYOUZDXYTXHNW-FNORWQNLSA-N. The full InChI is InChI=1S/C17H18OS/c1-13(2)7-5-12-17(18)19-16-11-6-9-14-8-3-4-10-15(14)16/h3-11,13H,12H2,1-2H3/b7-5+.
What are the key properties of S-naphthalen-1-yl (E)-5-methylhex-3-enethioate?
S-naphthalen-1-yl (E)-5-methylhex-3-enethioate has a molecular weight of 270.40 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-naphthalen-1-yl (E)-5-methylhex-3-enethioate is sourced from PubChem (CID 57382111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).