C33H34O — CID 139998255
2,10-dimethyl-3,9-dinaphthalen-1-ylundeca-4,7-dien-6-one (PubChem CID 139998255) has the molecular formula C33H34O and a molecular weight of 446.63 g/mol. Its IUPAC name is 2,10-dimethyl-3,9-dinaphthalen-1-ylundeca-4,7-dien-6-one.
| Compound Name | 2,10-dimethyl-3,9-dinaphthalen-1-ylundeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 139998255 |
| Molecular Formula | C33H34O |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2,10-dimethyl-3,9-dinaphthalen-1-ylundeca-4,7-dien-6-one |
| SMILES | CC(C)C(C=CC(=O)C=CC(c1cccc2ccccc12)C(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H34O/c1-23(2)28(32-17-9-13-25-11-5-7-15-30(25)32)21-19-27(34)20-22-29(24(3)4)33-18-10-14-26-12-6-8-16-31(26)33/h5-24,28-29H,1-4H3 |
| InChIKey | BHNQAMBWCRVHCH-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|