C14H15F3N4O3 — CID 57384736
5-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide (PubChem CID 57384736) has the molecular formula C14H15F3N4O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 5-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide.
| Compound Name | 5-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 57384736 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-hydroxy-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-methyl-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)N2N=C(C)CC2(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-9-7-13(23,14(15,16)17)21(20-9)12(22)19-18-8-10-3-5-11(24-2)6-4-10/h3-6,8,23H,7H2,1-2H3,(H,19,22)/b18-8+ |
| InChIKey | MJTPGBGKDMTVEE-QGMBQPNBSA-N |
| XLogP | 2.07 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|