C19H16ClF3N4O2 — CID 57384985
N-[(E)-(4-chlorophenyl)methylideneamino]-5-hydroxy-3-(4-methylphenyl)-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide (PubChem CID 57384985) has the molecular formula C19H16ClF3N4O2 and a molecular weight of 424.81 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-5-hydroxy-3-(4-methylphenyl)-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-5-hydroxy-3-(4-methylphenyl)-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 57384985 |
| Molecular Formula | C19H16ClF3N4O2 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-5-hydroxy-3-(4-methylphenyl)-5-(trifluoromethyl)-4H-pyrazole-1-carboxamide |
| SMILES | Cc1ccc(C2=NN(C(=O)N/N=C/c3ccc(Cl)cc3)C(O)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H16ClF3N4O2/c1-12-2-6-14(7-3-12)16-10-18(29,19(21,22)23)27(26-16)17(28)25-24-11-13-4-8-15(20)9-5-13/h2-9,11,29H,10H2,1H3,(H,25,28)/b24-11+ |
| InChIKey | JLGFFOFHJQMCQJ-BHGWPJFGSA-N |
| XLogP | 4.05 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|