C30H36N2O7S — CID 57385284
N-[3-[(2,5-dimethylphenyl)methoxy]-4-[6-hydroxyhexyl(methylsulfonyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 57385284) has the molecular formula C30H36N2O7S and a molecular weight of 568.69 g/mol. Its IUPAC name is N-[3-[(2,5-dimethylphenyl)methoxy]-4-[6-hydroxyhexyl(methylsulfonyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[(2,5-dimethylphenyl)methoxy]-4-[6-hydroxyhexyl(methylsulfonyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 57385284 |
| Molecular Formula | C30H36N2O7S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | N-[3-[(2,5-dimethylphenyl)methoxy]-4-[6-hydroxyhexyl(methylsulfonyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(C)c(COc2cc(NC(=O)c3ccc4c(c3)OCO4)ccc2N(CCCCCCO)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H36N2O7S/c1-21-8-9-22(2)24(16-21)19-37-28-18-25(31-30(34)23-10-13-27-29(17-23)39-20-38-27)11-12-26(28)32(40(3,35)36)14-6-4-5-7-15-33/h8-13,16-18,33H,4-7,14-15,19-20H2,1-3H3,(H,31,34) |
| InChIKey | ZWRRUGLYQCVNEI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|