About 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide
1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 57388810) has the molecular formula C13H14ClN5OS
and a molecular weight of 323.81 g/mol. Its IUPAC name is 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| PubChem CID | 57388810 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | CSc1ncc2c(n1)-c1c(c(C(N)=O)nn1CCCl)CC2 |
| InChI | InChI=1S/C13H14ClN5OS/c1-21-13-16-6-7-2-3-8-10(12(15)20)18-19(5-4-14)11(8)9(7)17-13/h6H,2-5H2,1H3,(H2,15,20) |
| InChIKey | VUNLIWFVLSRDRX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide?
The IUPAC name of 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (CID 57388810) is 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
What is the SMILES notation for 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide?
The canonical SMILES for 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide is CSc1ncc2c(n1)-c1c(c(C(N)=O)nn1CCCl)CC2.
What is the InChIKey of 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide?
The InChIKey is VUNLIWFVLSRDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5OS/c1-21-13-16-6-7-2-3-8-10(12(15)20)18-19(5-4-14)11(8)9(7)17-13/h6H,2-5H2,1H3,(H2,15,20).
What are the key properties of 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide?
1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide has a molecular weight of 323.81 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-8-methylsulfanyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide is sourced from PubChem (CID 57388810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).