C30H29F5N6O3S — CID 57388990
N-[(1R,3S)-3-[[3,5-difluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]amino]cyclohexyl]-3,3-difluoropyrrolidine-1-carboxamide (PubChem CID 57388990) has the molecular formula C30H29F5N6O3S and a molecular weight of 648.66 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[3,5-difluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]amino]cyclohexyl]-3,3-difluoropyrrolidine-1-carboxamide.
| Compound Name | N-[(1R,3S)-3-[[3,5-difluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]amino]cyclohexyl]-3,3-difluoropyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 57388990 |
| Molecular Formula | C30H29F5N6O3S |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | N-[(1R,3S)-3-[[3,5-difluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2-pyridinyl]amino]cyclohexyl]-3,3-difluoropyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3nc(N[C@H]4CCC[C@@H](NC(=O)N5CCC(F)(F)C5)C4)c(F)cc3F)c3cc(F)cnc32)cc1 |
| InChI | InChI=1S/C30H29F5N6O3S/c1-17-5-7-21(8-6-17)45(43,44)41-15-23(22-11-18(31)14-36-28(22)41)26-24(32)13-25(33)27(39-26)37-19-3-2-4-20(12-19)38-29(42)40-10-9-30(34,35)16-40/h5-8,11,13-15,19-20H,2-4,9-10,12,16H2,1H3,(H,37,39)(H,38,42)/t19-,20+/m0/s1 |
| InChIKey | IFVSKCHSSXGHDO-VQTJNVASSA-N |
| XLogP | 5.83 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |