C27H27N3O4 — CID 57390874
[4-[(2R)-2-[benzyl(methyl)carbamoyl]-6-oxopiperazin-1-yl]phenyl]methyl benzoate (PubChem CID 57390874) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-[(2R)-2-[benzyl(methyl)carbamoyl]-6-oxopiperazin-1-yl]phenyl]methyl benzoate.
| Compound Name | [4-[(2R)-2-[benzyl(methyl)carbamoyl]-6-oxopiperazin-1-yl]phenyl]methyl benzoate |
|---|---|
| PubChem CID | 57390874 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [4-[(2R)-2-[benzyl(methyl)carbamoyl]-6-oxopiperazin-1-yl]phenyl]methyl benzoate |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H]1CNCC(=O)N1c1ccc(COC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-29(18-20-8-4-2-5-9-20)26(32)24-16-28-17-25(31)30(24)23-14-12-21(13-15-23)19-34-27(33)22-10-6-3-7-11-22/h2-15,24,28H,16-19H2,1H3/t24-/m1/s1 |
| InChIKey | NLPOLQCVOYXLDX-XMMPIXPASA-N |
| XLogP | 3.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |