C12H10N2O4 — CID 57391932
5-ethyl-2-prop-2-ynoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 57391932) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-ethyl-2-prop-2-ynoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-prop-2-ynoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 57391932 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-ethyl-2-prop-2-ynoxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | C#CCOc1nc2oc(=O)cc(CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N2O4/c1-3-5-17-12-13-10(16)9-7(4-2)6-8(15)18-11(9)14-12/h1,6H,4-5H2,2H3,(H,13,14,16) |
| InChIKey | HUTUPDISCBBRKY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|