C20H15ClN4O — CID 57392126
5-(2-chloroanilino)-N-methylbenzo[c][2,6]naphthyridine-7-carboxamide (PubChem CID 57392126) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is 5-(2-chloroanilino)-N-methylbenzo[c][2,6]naphthyridine-7-carboxamide.
| Compound Name | 5-(2-chloroanilino)-N-methylbenzo[c][2,6]naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 57392126 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-(2-chloroanilino)-N-methylbenzo[c][2,6]naphthyridine-7-carboxamide |
| SMILES | CNC(=O)c1cccc2c1nc(Nc1ccccc1Cl)c1ccncc12 |
| InChI | InChI=1S/C20H15ClN4O/c1-22-20(26)14-6-4-5-12-15-11-23-10-9-13(15)19(25-18(12)14)24-17-8-3-2-7-16(17)21/h2-11H,1H3,(H,22,26)(H,24,25) |
| InChIKey | IXLHWDDKCRTAAT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|