C29H30F2N4O5 — CID 57395044
ethyl 2-[[2-[(4-carbamimidoylphenoxy)methyl]-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]-[(3,5-difluorophenyl)methyl]amino]-2-oxoacetate (PubChem CID 57395044) has the molecular formula C29H30F2N4O5 and a molecular weight of 552.58 g/mol. Its IUPAC name is ethyl 2-[[2-[(4-carbamimidoylphenoxy)methyl]-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]-[(3,5-difluorophenyl)methyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[2-[(4-carbamimidoylphenoxy)methyl]-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]-[(3,5-difluorophenyl)methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 57395044 |
| Molecular Formula | C29H30F2N4O5 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | ethyl 2-[[2-[(4-carbamimidoylphenoxy)methyl]-2,4-dimethyl-3H-1,4-benzoxazin-7-yl]-[(3,5-difluorophenyl)methyl]amino]-2-oxoacetate |
| SMILES | [H]/N=C(\N)c1ccc(OCC2(C)CN(C)c3ccc(N(Cc4cc(F)cc(F)c4)C(=O)C(=O)OCC)cc3O2)cc1 |
| InChI | InChI=1S/C29H30F2N4O5/c1-4-38-28(37)27(36)35(15-18-11-20(30)13-21(31)12-18)22-7-10-24-25(14-22)40-29(2,16-34(24)3)17-39-23-8-5-19(6-9-23)26(32)33/h5-14H,4,15-17H2,1-3H3,(H3,32,33) |
| InChIKey | XWODTYJWLAAROK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|