C29H28F3N3O8 — CID 71654374
ethyl 2-[benzyl-[(2R)-2-[(4-carbamimidoylphenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-2-oxoacetate;2,2,2-trifluoroacetic acid (PubChem CID 71654374) has the molecular formula C29H28F3N3O8 and a molecular weight of 603.55 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(2R)-2-[(4-carbamimidoylphenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-2-oxoacetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[benzyl-[(2R)-2-[(4-carbamimidoylphenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-2-oxoacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71654374 |
| Molecular Formula | C29H28F3N3O8 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | ethyl 2-[benzyl-[(2R)-2-[(4-carbamimidoylphenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-2-oxoacetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC[C@@H]2COc3cc(N(Cc4ccccc4)C(=O)C(=O)OCC)ccc3O2)cc1 |
| InChI | InChI=1S/C27H27N3O6.C2HF3O2/c1-2-33-27(32)26(31)30(15-18-6-4-3-5-7-18)20-10-13-23-24(14-20)35-17-22(36-23)16-34-21-11-8-19(9-12-21)25(28)29;3-2(4,5)1(6)7/h3-14,22H,2,15-17H2,1H3,(H3,28,29);(H,6,7)/t22-;/m1./s1 |
| InChIKey | GMMJRDKTZREEJG-VZYDHVRKSA-N |
| XLogP | 3.92 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|