C19H21FN4OS — CID 57397319
(5Z)-3-ethyl-2-ethylimino-5-[[1-(3-fluoro-2-pyridinyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 57397319) has the molecular formula C19H21FN4OS and a molecular weight of 372.47 g/mol. Its IUPAC name is (5Z)-3-ethyl-2-ethylimino-5-[[1-(3-fluoro-2-pyridinyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-ethyl-2-ethylimino-5-[[1-(3-fluoro-2-pyridinyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57397319 |
| Molecular Formula | C19H21FN4OS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (5Z)-3-ethyl-2-ethylimino-5-[[1-(3-fluoro-2-pyridinyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC/N=C1/S/C(=C\c2cc(C)n(-c3ncccc3F)c2C)C(=O)N1CC |
| InChI | InChI=1S/C19H21FN4OS/c1-5-21-19-23(6-2)18(25)16(26-19)11-14-10-12(3)24(13(14)4)17-15(20)8-7-9-22-17/h7-11H,5-6H2,1-4H3/b16-11-,21-19+ |
| InChIKey | RIBQXWFUZXZAGP-DDRRTAJHSA-N |
| XLogP | 3.94 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|