C20H27BN10O18P4- — CID 57397947
CID 57397947 (PubChem CID 57397947) has the molecular formula C20H27BN10O18P4- and a molecular weight of 830.20 g/mol.
| Compound Name | CID 57397947 |
|---|---|
| PubChem CID | 57397947 |
| Molecular Formula | C20H27BN10O18P4- |
| Molecular Weight | 830.20 g/mol |
| Exact Mass | 830.06 |
| IUPAC Name | — |
| SMILES | [B-]P(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H27BN10O18P4/c21-50(36,43-1-7-11(32)13(34)19(45-7)30-5-28-9-15(22)24-3-26-17(9)30)47-52(39,40)49-53(41,42)48-51(37,38)44-2-8-12(33)14(35)20(46-8)31-6-29-10-16(23)25-4-27-18(10)31/h3-8,11-14,19-20,32-35H,1-2H2,(H,37,38)(H,39,40)(H,41,42)(H2,22,24,26)(H2,23,25,27)/q-1/t7-,8-,11-,12-,13-,14-,19-,20-,50?/m1/s1 |
| InChIKey | NSVWLUDFHSGIRQ-FFNSPZBXSA-N |
| XLogP | -2.27 |
| TPSA | 413.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.20 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|