C19H23NO5 — CID 57400546
N-methoxy-2-(4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)ethanimine (PubChem CID 57400546) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-methoxy-2-(4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)ethanimine.
| Compound Name | N-methoxy-2-(4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 57400546 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-methoxy-2-(4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)ethanimine |
| SMILES | CON=C(Cc1ccc(OC)cc1)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C19H23NO5/c1-21-14-8-6-13(7-9-14)12-16(20-25-5)15-10-11-17(22-2)19(24-4)18(15)23-3/h6-11H,12H2,1-5H3 |
| InChIKey | HNVUVPILHDYIBF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|