C17H22F3NO2 — CID 57404446
4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine;2,2,2-trifluoroacetic acid (PubChem CID 57404446) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 57404446 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc2c(c(C3CCNCC3)c1)CCCC2 |
| InChI | InChI=1S/C15H21N.C2HF3O2/c1-2-6-14-12(4-1)5-3-7-15(14)13-8-10-16-11-9-13;3-2(4,5)1(6)7/h3,5,7,13,16H,1-2,4,6,8-11H2;(H,6,7) |
| InChIKey | YZLNBPAZPMGEMJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |