C20H26F6N2O4 — CID 21182439
1-(4-phenylcyclohexyl)piperazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 21182439) has the molecular formula C20H26F6N2O4 and a molecular weight of 472.43 g/mol. Its IUPAC name is 1-(4-phenylcyclohexyl)piperazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(4-phenylcyclohexyl)piperazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 21182439 |
| Molecular Formula | C20H26F6N2O4 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 1-(4-phenylcyclohexyl)piperazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(C2CCC(N3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C16H24N2.2C2HF3O2/c1-2-4-14(5-3-1)15-6-8-16(9-7-15)18-12-10-17-11-13-18;2*3-2(4,5)1(6)7/h1-5,15-17H,6-13H2;2*(H,6,7) |
| InChIKey | YJMZRISOAVIOBB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |