C18H24N6 — CID 57404842
5-[2-(cyclopentylamino)pyrimidin-4-yl]-4-(cyclopropylmethyl)-N-methylpyrimidin-2-amine (PubChem CID 57404842) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-[2-(cyclopentylamino)pyrimidin-4-yl]-4-(cyclopropylmethyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-[2-(cyclopentylamino)pyrimidin-4-yl]-4-(cyclopropylmethyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 57404842 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 5-[2-(cyclopentylamino)pyrimidin-4-yl]-4-(cyclopropylmethyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(-c2ccnc(NC3CCCC3)n2)c(CC2CC2)n1 |
| InChI | InChI=1S/C18H24N6/c1-19-17-21-11-14(16(24-17)10-12-6-7-12)15-8-9-20-18(23-15)22-13-4-2-3-5-13/h8-9,11-13H,2-7,10H2,1H3,(H,19,21,24)(H,20,22,23) |
| InChIKey | LJLFUUKTMCPDBS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |