C23H17FN2O5 — CID 57407613
methyl (3aS,4R,6aS)-5'-fluoro-1'-methyl-1,2',3-trioxo-2-phenylspiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate (PubChem CID 57407613) has the molecular formula C23H17FN2O5 and a molecular weight of 420.40 g/mol. Its IUPAC name is methyl (3aS,4R,6aS)-5'-fluoro-1'-methyl-1,2',3-trioxo-2-phenylspiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate.
| Compound Name | methyl (3aS,4R,6aS)-5'-fluoro-1'-methyl-1,2',3-trioxo-2-phenylspiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate |
|---|---|
| PubChem CID | 57407613 |
| Molecular Formula | C23H17FN2O5 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | methyl (3aS,4R,6aS)-5'-fluoro-1'-methyl-1,2',3-trioxo-2-phenylspiro[3a,6a-dihydrocyclopenta[c]pyrrole-4,3'-indole]-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2[C@]12C(=O)N(C)c1ccc(F)cc12 |
| InChI | InChI=1S/C23H17FN2O5/c1-25-17-9-8-12(24)10-15(17)23(22(25)30)16(21(29)31-2)11-14-18(23)20(28)26(19(14)27)13-6-4-3-5-7-13/h3-11,14,18H,1-2H3/t14-,18+,23+/m0/s1 |
| InChIKey | BHLRAHRSTZFKMK-FPULEUEGSA-N |
| XLogP | 1.96 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|