C36H30NO2P — CID 57407981
2-[[(12R,13R)-13-(2,4-dimethoxyphenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]methyl]pyridine (PubChem CID 57407981) has the molecular formula C36H30NO2P and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-[[(12R,13R)-13-(2,4-dimethoxyphenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]methyl]pyridine.
| Compound Name | 2-[[(12R,13R)-13-(2,4-dimethoxyphenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]methyl]pyridine |
|---|---|
| PubChem CID | 57407981 |
| Molecular Formula | C36H30NO2P |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 2-[[(12R,13R)-13-(2,4-dimethoxyphenyl)-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-12-yl]methyl]pyridine |
| SMILES | COc1ccc([P@]2Cc3ccc4ccccc4c3-c3c(ccc4ccccc34)[C@H]2Cc2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C36H30NO2P/c1-38-28-17-19-33(32(22-28)39-2)40-23-26-15-14-24-9-3-5-12-29(24)35(26)36-30-13-6-4-10-25(30)16-18-31(36)34(40)21-27-11-7-8-20-37-27/h3-20,22,34H,21,23H2,1-2H3/t34-,40+/m1/s1 |
| InChIKey | RLFDGYBLELEWKV-IKCXEYKWSA-N |
| XLogP | 8.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|