C24H21N5O2S — CID 57408298
10-(4-azidobutyl)-1-(benzenesulfonyl)pyrrolo[2,3-a]carbazole (PubChem CID 57408298) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is 10-(4-azidobutyl)-1-(benzenesulfonyl)pyrrolo[2,3-a]carbazole.
| Compound Name | 10-(4-azidobutyl)-1-(benzenesulfonyl)pyrrolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 57408298 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 10-(4-azidobutyl)-1-(benzenesulfonyl)pyrrolo[2,3-a]carbazole |
| SMILES | [N-]=[N+]=NCCCCn1c2ccccc2c2ccc3ccn(S(=O)(=O)c4ccccc4)c3c21 |
| InChI | InChI=1S/C24H21N5O2S/c25-27-26-15-6-7-16-28-22-11-5-4-10-20(22)21-13-12-18-14-17-29(23(18)24(21)28)32(30,31)19-8-2-1-3-9-19/h1-5,8-14,17H,6-7,15-16H2 |
| InChIKey | KJYVHZNHGZRIQG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|