C11H18O5 — CID 57408723
methyl (3S,6S)-6-formyl-6-methyl-3-propan-2-yldioxane-3-carboxylate (PubChem CID 57408723) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl (3S,6S)-6-formyl-6-methyl-3-propan-2-yldioxane-3-carboxylate.
| Compound Name | methyl (3S,6S)-6-formyl-6-methyl-3-propan-2-yldioxane-3-carboxylate |
|---|---|
| PubChem CID | 57408723 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl (3S,6S)-6-formyl-6-methyl-3-propan-2-yldioxane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C(C)C)CC[C@@](C)(C=O)OO1 |
| InChI | InChI=1S/C11H18O5/c1-8(2)11(9(13)14-4)6-5-10(3,7-12)15-16-11/h7-8H,5-6H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | KJKAPZWSFSTIRG-QWRGUYRKSA-N |
| XLogP | 1.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|