C19H36O4 — CID 57409305
(4R,6S)-4-tert-butyl-6-[[(4S,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 57409305) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is (4R,6S)-4-tert-butyl-6-[[(4S,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-tert-butyl-6-[[(4S,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 57409305 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | (4R,6S)-4-tert-butyl-6-[[(4S,6R)-6-ethyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | CC[C@@H]1C[C@@H](C[C@H]2C[C@H](C(C)(C)C)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H36O4/c1-9-13-10-14(21-18(5,6)20-13)11-15-12-16(17(2,3)4)23-19(7,8)22-15/h13-16H,9-12H2,1-8H3/t13-,14+,15+,16-/m1/s1 |
| InChIKey | QMAZGESTIFIKSM-FXUDXRNXSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |