C16H24O2 — CID 10083371
(4R,6S)-4-tert-butyl-2,2-dimethyl-6-phenyl-1,3-dioxane (PubChem CID 10083371) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (4R,6S)-4-tert-butyl-2,2-dimethyl-6-phenyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-tert-butyl-2,2-dimethyl-6-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 10083371 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (4R,6S)-4-tert-butyl-2,2-dimethyl-6-phenyl-1,3-dioxane |
| SMILES | CC1(C)O[C@H](c2ccccc2)C[C@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C16H24O2/c1-15(2,3)14-11-13(17-16(4,5)18-14)12-9-7-6-8-10-12/h6-10,13-14H,11H2,1-5H3/t13-,14+/m0/s1 |
| InChIKey | IUOVSLQAVCLTOD-UONOGXRCSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |