C17H24FNO4 — CID 57410438
propan-2-yl (2R)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 57410438) has the molecular formula C17H24FNO4 and a molecular weight of 325.40 g/mol. Its IUPAC name is propan-2-yl (2R)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | propan-2-yl (2R)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 57410438 |
| Molecular Formula | C17H24FNO4 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | propan-2-yl (2R)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](CC1=CC=CC=C1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24FNO4/c1-11(2)22-15(20)14(19-16(21)23-17(3,4)5)10-12-8-6-7-9-13(12)18/h6-9,11,14H,10H2,1-5H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | QINBKCXBKAVAIW-CQSZACIVSA-N |
| XLogP | 3.70 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 406 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |